Details for Adipic Acid Diglycidyl Ester

Adipic Acid Diglycidyl Ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2754-17-8 |
EC NO: |
220-403-7 |
Molecular Formula: |
C12H18O6 |
Molecular Weight: |
258.2677 |
Specification: |
|
InChI: |
InChI=1/C12H18O6/c13-11(17-7-9-5-15-9)3-1-2-4-12(14)18-8-10-6-16-10/h9-10H,1-8H2 |
Synonyms: |
Bis(2,3-epoxypropyl) adipate;Hexanedioic acid, bis(oxiranylmethyl) ester;bis(oxiran-2-ylmethyl) hexanedioate; |
Molecular Structure: |
 |
if you are sourcing Adipic Acid Diglycidyl Ester from China ,just feel free to inquire