Details for Diethylene Glycol Diglycidyl Ether
![](/images/home/newal1.gif)
Diethylene Glycol Diglycidyl Ether
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
39443-66-8 |
EC NO: |
|
Molecular Formula: |
(C2H4O)n¡¤C6H10O3 |
Molecular Weight: |
|
Specification: |
|
InChI: |
InChI=1/C6H10O3.C4H10O3/c1(5-3-8-5)7-2-6-4-9-6;5-1-3-7-4-2-6/h5-6H,1-4H2;5-6H,1-4H2 |
Synonyms: |
Epichlorohydrin-polyethylene glycol copolymer;2,2'-oxydiethanol - 2,2'-(oxydimethanediyl)dioxirane (1:1);Diethylene glycol diglycidyl ether; |
Molecular Structure: |
![Diethylene Glycol Diglycidyl Ether 39443-66-8](https://images-a.chemnet.com/suppliers/chembase/cas8/cas39443-66-8.gif) |
if you are sourcing Diethylene Glycol Diglycidyl Ether from China ,just feel free to inquire