Details for Dimethyl Succinate

Dimethyl Succinate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
106-65-0 |
EC NO: |
203-419-9 |
Molecular Formula: |
C6H10O4 |
Molecular Weight: |
146.1412 |
Specification: |
|
InChI: |
InChI:1S/C6H10O4/c1-9-5(7)3-4-6(8)10-2/h3-4H2,1-2H3 |
Synonyms: |
Methyl succinate;DBE-9 dibasic ester;Succinic Acid Dimethyl Ester;DIMETHYLE SUCCINATE;Alkane-(C4,C5,C6)-dioic acid dimethyl ester;Butanedioic acid dimethyl ester;dimethyl butanedioate; |
Molecular Structure: |
 |
if you are sourcing Dimethyl Succinate from China ,just feel free to inquire