Details for Sorbitol Diglycidyl Ether

Sorbitol Diglycidyl Ether
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
68412-01-1 |
EC NO: |
270-160-6 |
Molecular Formula: |
C9H19ClO7 |
Molecular Weight: |
274.696 |
Specification: |
|
InChI: |
InChI=1/C6H14O6.C3H5ClO/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3-2-5-3/h3-12H,1-2H2;3H,1-2H2/t3-,4+,5-,6-;/m1./s1 |
Synonyms: |
D-Glucitol, reaction products with epichlorohydrin;Sorbitol, diether with methyloxirane;2-(chloromethyl)oxirane - D-glucitol (1:1); |
Molecular Structure: |
 |
if you are sourcing Sorbitol Diglycidyl Ether from China ,just feel free to inquire