Details for DL-Ethyl 2-bromopropionate
DL-Ethyl 2-bromopropionate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
535-11-5 |
EC NO: |
208-609-5 |
Molecular Formula: |
C5H9BrO2 |
Molecular Weight: |
181.0278 |
Specification: |
|
InChI: |
InChI=1/C5H9BrO2/c1-3-8-5(7)4(2)6/h4H,3H2,1-2H3/t4-/m1/s1 |
Synonyms: |
2-bromopropanoic acid ethyl ester;Ethyl 2-bromopropionate;2-Bromopropionic Acid Ethylester;2-Bromopropionic acid ethyl ester;ethyl 2-bromopropanoate;ethyl (2S)-2-bromopropanoate;ethyl (2R)-2-bromopropanoate;Ethyl alpha-bromopropanoate;Propanoicacid,2-bromo-,ethylester;Ethyl bromopropionate;Ethyl-2-bromopropionate; |
Molecular Structure: |
|
if you are sourcing DL-Ethyl 2-bromopropionate from China ,just feel free to inquire