Details for Polystyrene
Polystyrene
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
9003-53-6 |
EC NO: |
|
Molecular Formula: |
C8H8 |
Molecular Weight: |
104.1491 |
Specification: |
|
InChI: |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
Synonyms: |
Polystyrene;polystyrene standard 4000000;polystyrene standard 2000000;polystyrene standard 300000;polystyrene standard 1000000;polystyrene standard 700000;polystyrene standard 650000;polystyrene standard 2200000 certi-fied acc. to din;polystyrene standard 500000;polystyrene standard 8000000;Polystyrene (General Purpose Grade);Polystyrene, dicarboxy terminated;Polystyrene, methacrylate terminated solution;Styrene Resin (High M.Wt.);Styrene Latex;Styrene Resin (Low M.Wt.);Styrene Resin (Med.M.Wt.);Styrene-divinylbenzene copolymer (20% cross-linked);Polystyrene2% crosslinked with vinylbenzene;EPS;Expandable Polystyrene; |
Molecular Structure: |
|
if you are sourcing Polystyrene from South-Africa ,just feel free to inquire