Details for 3-Chlorobenzoyl chloride

3-Chlorobenzoyl chloride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
618-46-2 |
EC NO: |
210-552-6 |
Molecular Formula: |
C7H4Cl2O |
Molecular Weight: |
175.01 |
Specification: |
99% min |
InChI: |
InChI=1/C7H4Cl2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
Packing: |
200 litres metallic drums with a polyethylene inner bag |
Product description:
CAS N.620-20-2
Clear, colorless liquid. |
Synonyms: |
m-Chlorobenzoyl chloride;m-chlorobenzoylchloride; |
Molecular Structure: |
 |
if you are sourcing 3-Chlorobenzoyl chloride from Italy ,just feel free to inquire