Details for Ethylene Glycol Butyl Ether Acetate
![](/images/home/newal1.gif)
Ethylene Glycol Butyl Ether Acetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
112-07-2 |
EC NO: |
203-933-3 |
Molecular Formula: |
C8H18O3 |
Molecular Weight: |
160.21324 |
Specification: |
|
InChI: |
InChI=1/C6H12O2.C2H6O2/c1-3-4-5-8-6(2)7;3-1-2-4/h3-5H2,1-2H3;3-4H,1-2H2 |
Synonyms: |
Ethylene Glylol Butylether Acetate;Acetic Acid 2-Butoxyethyl Ester;1-Acetoxy-2-Butoxyethane;2-N-Butoxyethyl Acetate;Ethylene Glycol Monobutyl Ether Acetate;Ethyleneglycol Monobutyl Ester Acetate;Ethylene Glycol Mono-N-Butyl Ether Acetate;Ethylene Glycol Butyl Ether Acetate;Ethylene Glycol Monobutyl Ether Acetate(Bac);Butyl Acetate-Ethane-1,2-Diol (1:1);Bac;BGA; |
Molecular Structure: |
![Ethylene Glycol Butyl Ether Acetate 112-07-2](https://images-a.chemnet.com/suppliers/chembase/199/199705_1.gif) |
if you are sourcing Ethylene Glycol Butyl Ether Acetate from China ,just feel free to inquire