Details for ethyl caproate
ethyl caproate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
123-66-0 |
EC NO: |
204-640-3 |
Molecular Formula: |
C8H16O2 |
Molecular Weight: |
144.2114 |
Specification: |
|
InChI: |
InChI=1/C8H16O2/c1-3-5-6-7-8(9)10-4-2/h3-7H2,1-2H3 |
Product description:
Density: |
0.878g/cm3 |
Melting Point(℃): |
-67℃ |
Boiling Point(℃): |
167.9°C at 760 mmHg |
Flash Point(℃): |
49.4°C |
refractive_index: |
1.412 |
|
Synonyms: |
Ethyl hexanoate;ethyl caproate (ethyl hexanoate);Caproic acid ethyl ester;Hexanoic acid ethyl ester;NATURAL ETHYL HEXANOATE;ethyl caproate; |
Molecular Structure: |
|
if you are sourcing ethyl caproate from China ,just feel free to inquire