Details for 1-Cyclohexenylacetic Acid
![](/images/home/newal1.gif)
1-Cyclohexenylacetic Acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
18294-87-6 |
EC NO: |
242-172-1 |
Molecular Formula: |
C8H11O2 |
Molecular Weight: |
139.1723 |
Specification: |
|
InChI: |
InChI=1/C8H12O2/c9-8(10)6-7-4-2-1-3-5-7/h4H,1-3,5-6H2,(H,9,10)/p-1 |
Synonyms: |
-1-CYCLOHEXENYLACETIC ACID;1-Cyclohexene-1-acetic acid;1-Cyclohexenyl acetic acid;RARECHEM AL BO 0007;TIMTEC-BB SBB008386;1-Cyclohexen-1-ylacetic acid;1-Cyclohexene-1-aceticacid;cyclohex-1-enylacetic acid;1-Cyclohexenyl;NSC14103;cyclohex-1-en-1-ylacetic acid;cyclohex-1-en-1-ylacetate; |
Molecular Structure: |
![1-Cyclohexenylacetic Acid 18294-87-6](https://images-a.chemnet.com/suppliers/chembase/146/146631_1.gif) |
if you are sourcing 1-Cyclohexenylacetic Acid from United-States ,just feel free to inquire