Details for Benzyl phenyl ether, Pract.

Benzyl phenyl ether, Pract.
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
946-80-5 |
EC NO: |
250-571-7 |
Molecular Formula: |
C13H12O |
Molecular Weight: |
184.2338 |
Specification: |
|
InChI: |
InChI=1/C13H12O/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
Synonyms: |
(Benzyloxy)benzene;.alpha.-Phenylanisole;946-80-5;Anisole, .alpha.-phenyl-;Anisole, alpha-phenyl-;Benzene, (phenoxymethyl)-;Benzyl Phenyl Ether;Benzyl phenyl ether, Pract.;Ether, benzyl phenyl; |
Molecular Structure: |
 |
if you are sourcing Benzyl phenyl ether, Pract. from United-States ,just feel free to inquire