Details for Ethyl 4-acetyl-5-oxohexanoate
![](/images/home/newal1.gif)
Ethyl 4-acetyl-5-oxohexanoate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
2832-10-2 |
EC NO: |
|
Molecular Formula: |
C10H16O4 |
Molecular Weight: |
200.2316 |
Specification: |
|
InChI: |
InChI=1/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h11H,4-6H2,1-3H3/b9-7+ |
Synonyms: |
Ethyl 4,4-diacetylbutyrate;4-Acetyl-5-oxohexanoic acid ethyl ester;2-(Ethoxycarbonylethyl)acetylacetone~Ethyl 4,4-diacetylbutyrate;ethyl (4E)-4-acetyl-5-hydroxyhex-4-enoate; |
Molecular Structure: |
![Ethyl 4-acetyl-5-oxohexanoate 2832-10-2](https://images-a.chemnet.com/suppliers/chembase/cas/cas2832-10-2.gif) |
if you are sourcing Ethyl 4-acetyl-5-oxohexanoate from United-States ,just feel free to inquire