Details for Hexahydrocumic acid
Hexahydrocumic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
7077-05-6 |
EC NO: |
230-375-8 |
Molecular Formula: |
C10H18O2 |
Molecular Weight: |
170.25 |
Specification: |
|
InChI: |
InChI=1/C10H18O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h7-9H,3-6H2,1-2H3,(H,11,12) |
Synonyms: |
hexahydrocumic acid;trans-4-isopropylcyclohexanecarboxylic acid;trans-4-(1-methylethyl)cyclohexane carboxylic acid;trans-4-isopropyl cyclohexyl carboxylic acid;trans-4-isopropyl cyclohexane carboxylic acid;Trans-4-isopropylcyclohexane Carboxylic Acid(Nateglinide);trans-p-Isopropylcyclohexanecarboxylic acid; |
Molecular Structure: |
|
if you are sourcing Hexahydrocumic acid from United-States ,just feel free to inquire