Details for Methyl 4-Phenylbenzoate
Methyl 4-Phenylbenzoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
720-75-2 |
EC NO: |
211-954-4 |
Molecular Formula: |
C14H18O2 |
Molecular Weight: |
218.2915 |
Specification: |
|
InChI: |
InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
Synonyms: |
P-phenylbenzoic acid methyl ester;p-Phenylbenzoic acid-OMe;Methyl 4-Phenylbenzoate;4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate;methyl biphenyl-4-carboxylate;methyl 4-phenylcyclohexanecarboxylate; |
Molecular Structure: |
|
if you are sourcing Methyl 4-Phenylbenzoate from United-States ,just feel free to inquire