Details for 1,4-Diiodobenzene

1,4-Diiodobenzene
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
624-38-4 |
EC NO: |
210-842-2 |
Molecular Formula: |
C6H4I2 |
Molecular Weight: |
329.9049 |
Specification: |
GC≥99.0% |
InChI: |
InChI=1/C6H4I2/c7-5-1-2-6(8)4-3-5/h1-4H |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 1,4-Diiodobenzene
CAS No. 624-38-4
Content: GC≥99.0%
Appearance: pale yellow crystal;
Packing: 20kg/drum or on request;
Productivity: 10 Tons/M
|
Uses: |
OLED intermediates |
Synonyms: |
p-Diiodobenzene;Benzene, 1,4-iodo-;Benzene, p-diiodo-;1,4-Diidobenzene; |
Molecular Structure: |
 |
if you are sourcing 1,4-Diiodobenzene from China ,just feel free to inquire