Details for 1-(Trans-4-pentylcyclohexyl)-4-iodobenzene

1-(Trans-4-pentylcyclohexyl)-4-iodobenzene
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
116963-80-5 |
EC NO: |
|
Molecular Formula: |
C17H25I |
Molecular Weight: |
356.2849 |
Specification: |
GC≥990.5% |
InChI: |
InChI=1/C17H25I/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h10-15H,2-9H2,1H3/t14-,15- |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 1-(Trans-4-pentylcyclohexyl)-4-iodobenzene
CAS No. 116963-80-5
Content: GC≥990.5%
Appearance: white crystal
Packing: 20kg/drum or on request;
Productivity: 5Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4-trans(4-n-pentyl cyclohexyl) iodobenzene; |
Molecular Structure: |
 |
if you are sourcing 1-(Trans-4-pentylcyclohexyl)-4-iodobenzene from China ,just feel free to inquire