Details for 1-Bromo-3-fluoro-4-iodobenzene

1-Bromo-3-fluoro-4-iodobenzene
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
105931-73-5 |
EC NO: |
|
Molecular Formula: |
C6H3BrFI |
Molecular Weight: |
300.8949 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 1-Bromo-3-fluoro-4-iodobenzene
CAS No. 105931-73-5
Content: GC≥99.5%
Appearance: white crystal;
Packing: 20kg/drum or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4-Bromo-2-fluoro-1-iodobenzene;4-Bromo-2-fluoroiodobenzene;2-fluoro-4-Bromoiodobenzene;3-Fluoro-4-iodobromobenzene; |
Molecular Structure: |
 |
if you are sourcing 1-Bromo-3-fluoro-4-iodobenzene from China ,just feel free to inquire