Details for 1-Bromo-4-butylbenzene

1-Bromo-4-butylbenzene
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
41492-05-1 |
EC NO: |
|
Molecular Formula: |
C10H13Br |
Molecular Weight: |
213.1142 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C10H13Br/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 1-Bromo-4-butylbenzene
CAS No. 41492-05-1
Content: GC≥99.5%
Appearance: Colorless transparent liquid ;
Packing: PTFE barrel or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4-n-Butylbromobenzene; |
Molecular Structure: |
 |
if you are sourcing 1-Bromo-4-butylbenzene from China ,just feel free to inquire