111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
1121-86-4 |
EC NO: |
214-339-9 |
Molecular Formula: |
C6H5BBrFO2 |
Molecular Weight: |
218.8161 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C6H5BBrFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 1-Fluoro-3-iodobenzene
CAS No. 1121-86-4
Content: GC≥99.5%
Appearance: colorless to pale yellow transparent liquid;
Packing: PTFE barrel or on request;
Productivity: 5Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
m-fluoroiodobenzene;1-fluoro-3-iodobenzene;(5-bromo-2-fluorophenyl)boronic acid; |
Molecular Structure: |
 |