Details for 3-Ethoxyphenylboronic acid

3-Ethoxyphenylboronic acid
111Category: |
Intermediates/Others |
|
CAS NO: |
90555-66-1 |
EC NO: |
|
Molecular Formula: |
C8H11BO3 |
Molecular Weight: |
165.9821 |
Specification: |
HPLC≥98.0% |
InChI: |
InChI=1/C8H11BO3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name:3-Ethoxyphenylboronic acid
CAS No. 90555-66-1
Content: HPLC≥98.0%
Appearance: white powder
Packing: 20kg/drum or on request;
Productivity: 5Tons/M
|
Uses: |
pharmaceutical intermediates |
Synonyms: |
-RARECHEM AH PB 0139;M-ETHOXYPHENYLBORONIC ACID;3-ETHOXYBENZENEBORONIC ACID;AKOS BRN-0069;3-Ethoxyphenylboronic Acid (contains varying amounts of Anhydride);3-Ethoxyphenylboronic acid ,98%; |
Molecular Structure: |
 |
if you are sourcing 3-Ethoxyphenylboronic acid from China ,just feel free to inquire