111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
458-50-4 |
EC NO: |
|
Molecular Formula: |
C7H6BrFO |
Molecular Weight: |
205.0243 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C7H6BrFO/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 4-Bromo-3-fluoroanisole
CAS No. 458-50-4
Content: GC≥99.5%
Appearance: Colorless transparent liquid ;
Packing: PTFE barrel or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
1-Brom-2-fluor-4-methoxybenzol;1-Bromo-2-fluoro-4-methoxybenzene;4-Bromo-3-fluorophenyl methyl ether;Benzene, 1-bromo-2-fluoro-4-methoxy-;FR BE EO1; |
Molecular Structure: |
 |