Details for 4-Iodoaniline

4-Iodoaniline
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
540-37-4 |
EC NO: |
208-743-4 |
Molecular Formula: |
C6H6IN |
Molecular Weight: |
219.023 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C6H6IN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2 |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 4-Iodoaniline
CAS No. 540-37-4
Content: GC≥99.5%
Appearance: pale yellow crystal;
Packing: 20kg/drum or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4-Indo Aniline;P-IODOANILINE;4-iodo-benzenamin;Iodoaniline, 4-; |
Molecular Structure: |
 |
if you are sourcing 4-Iodoaniline from China ,just feel free to inquire