Details for 4-Iodoanisole

4-Iodoanisole
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
696-62-8 |
EC NO: |
211-798-7 |
Molecular Formula: |
C7H7IO |
Molecular Weight: |
234.0343 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C7H7IO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 4-Iodoanisole
CAS No. 696-62-8
Content: GC≥99.5%
Appearance: white crystal;
Packing: 20kg/drum or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
1-Iodo-4-methoxybenzene;4-lodoanisole;4-Methoxy-iodobenzene;4-Iodoanisole;4-Iodomethoxybenzene; |
Molecular Structure: |
 |
if you are sourcing 4-Iodoanisole from China ,just feel free to inquire