Details for 4-Iodobenzonitrile

4-Iodobenzonitrile
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
3058-39-7 |
EC NO: |
|
Molecular Formula: |
C7H4IN |
Molecular Weight: |
229.0178 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C7H4IN/c8-7-3-1-6(5-9)2-4-7/h1-4H |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 4-Iodobenzonitrile
CAS No. 3058-39-7
Content: GC≥99.5%
Appearance: white crystal
Packing: 20kg/drum or on request;
Productivity: 5Tons/M
|
Uses: |
liquid crystal intermedates |
Synonyms: |
Benzonitrile, 4-iodo-;NSC 87894;p-Cyanoiodobenzene;p-Iodobenzonitrile;Benzonitrile, p-iodo- (8CI);1-Cyano-4-iodobenzene;4-Iodo Benzonitrile; |
Molecular Structure: |
 |
if you are sourcing 4-Iodobenzonitrile from China ,just feel free to inquire