111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
624-31-7 |
EC NO: |
210-841-7 |
Molecular Formula: |
C7H7I |
Molecular Weight: |
218.0349 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C7H7I/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 4-Iodotoluene
CAS No. 624-31-7
Content: GC≥99.5%
Appearance: pale yellow to colorless transparent liquid
Packing: PTFE barrel or on request;
Productivity: 5Tons/M
|
Uses: |
OLED intermediates, liquid crystal intermediates |
Synonyms: |
1-iodo-4-methyl-benzen;p-Iodotoluene;1-iodo-4-methylbenzene;Benzene, 1-iodo-4-methyl-;4-lodotoluene;p-Iodomethylbenzene; |
Molecular Structure: |
 |