Details for 4-Methylphenylacetylene

4-Methylphenylacetylene
111Category: |
Intermediates |
|
CAS NO: |
766-97-2 |
EC NO: |
|
Molecular Formula: |
C9H8 |
Molecular Weight: |
116.1598 |
Specification: |
GC≥98.0% |
InChI: |
InChI=1/C9H8/c1-3-9-6-4-8(2)5-7-9/h1,4-7H,2H3 |
Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 4-Methylphenylacetylene
CAS No. 766-97-2
Content: GC≥98.0%
Appearance: pale yellow to colorless transparent liquid;
Packing: PTFE barrel or on request;
Productivity: 1Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
1-Ethynyl-4-methylbenzene;1-Ethynyltoluene;4-Methylphenylacetylene;p-Tolyacetylene;1-ethynyl-4-methylbenzene;4-Methyl phenylacetylene;p-TOLYLACETYLENE; |
Molecular Structure: |
 |
if you are sourcing 4-Methylphenylacetylene from China ,just feel free to inquire