Details for 4-iodo-4'-methylbiphenyl

4-iodo-4'-methylbiphenyl
111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
55290-86-3 |
EC NO: |
|
Molecular Formula: |
C13H11I |
Molecular Weight: |
294.1309 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C13H11I/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12/h2-9H,1H3 |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 4-iodo-4'-methylbiphenyl
CAS No. 55290-86-3
Content: GC≥99.5%
Appearance: white crystal
Packing: 20kg/drum or on request;
Productivity: 5Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4'-Iodo-4-methyl-biphenyl; |
Molecular Structure: |
 |
if you are sourcing 4-iodo-4'-methylbiphenyl from China ,just feel free to inquire