Details for 2,4-dichloromethylbenzene

2,4-dichloromethylbenzene
| Category: |
Agrochemicals |
|
| CAS NO: |
95-73-8 |
| EC NO: |
202-445-8 |
| Molecular Formula: |
C7H6Cl2 |
| Molecular Weight: |
161.0285 |
| Specification: |
|
| InChI: |
InChI=1/C7H6Cl2/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| Packing: |
250KG/drum |
Product description:
Molecular Formula:C7H6Cl2
|
| Uses: |
It can be applied in making of pharmacy and pesticide etc |
| Synonyms: |
2,4-dichloro-1-methylbenzene;2,4-dichloromethylbenzene;2,4-DCT; |
| Molecular Structure: |
 |
if you are sourcing 2,4-dichloromethylbenzene from China ,just feel free to inquire