Details for N-Phenyl-1-naphthylamine
N-Phenyl-1-naphthylamine
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
90-30-2 |
| EC NO: |
201-983-0 |
| Molecular Formula: |
C16H13N |
| Molecular Weight: |
219.28 |
| Specification: |
|
| InChI: |
InChI=1/C16H13N/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-12,17H |
| Synonyms: |
C.I. 44050;1-Naphthylamine, N-phenyl-;1-anilinonaphthalene;bis-(4,4')-n-phenyl-1-naphthylamine;tim tec-bb sbb000591;n-1-naphthylaniline;naphthalen-1-yl-phenyl-amine;phenyl alpha naphthylamine;n-(1-naphthyl)aniline;antioxidant a; |
| Molecular Structure: |
 |
if you are sourcing N-Phenyl-1-naphthylamine from China ,just feel free to inquire
CN
China Suppliers > Orient Union > 
Search Product