Details for o-Chlorobenzyl Chloride
o-Chlorobenzyl Chloride
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
611-19-8 |
| EC NO: |
210-258-8 |
| Molecular Formula: |
C7H6Cl2 |
| Molecular Weight: |
161.0285 |
| Specification: |
|
| InChI: |
InChI=1/C7H6Cl2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| Synonyms: |
OCBC;alpha,2-Dichlorotoluene;1-chloro-2-(chloromethyl)-Benzene;o-chlorobenzyl chloride;SOLFAC(R);ortho-chlorobenzylchloride;ortho chlorobenzyl chloride;1-chloro-2-(chloromethyl)-benzen;Ortho Chloro Benzyl Chloride; |
| Molecular Structure: |
 |
if you are sourcing o-Chlorobenzyl Chloride from China ,just feel free to inquire
CN
China Suppliers > Orient Union > 
Search Product