year
111Category: | Metals and Minerals/Others |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS NO: | 25306-75-6 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
EC NO: | 246-805-2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Formula: | C5H9NaOS2 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Weight: | 172.2441 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Specification: | B1-04 Dry product, B1-04 Synthetics (Special grade, First grade, Qualified), B1-24 Dry product, B1-24 Synthetics (First grade, Qualified) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI: | InChI=1/C5H10OS2.Na/c1-4(2)3-6-5(7)8;/h4H,3H2,1-2H3,(H,7,8);/q;+1/p-1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Packing: | Barrel or bag packaging, net weight 110kg or 150kg/barrel, 50kg/bag. Granular xanthate is packed with wooden case, net weight 850kg. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Product description: Manufacturer: SINOPEC SHANGHAI PETROCHEMICAL CO., LTD ?
?
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Uses: | Sodium (potassium) Isobutyl Xanthate is also a powerful collector for the flotation of various sulfide ores, particular effective to the flotation of various chalcopyrite and pyrite. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms: | Carbonodithioic acid, O-(2-methylpropyl) ester, sodium salt (1:1);Carbonodithioic acid, O-(2-methylpropyl) ester, sodium salt;Sodium O-isobutyl dithiocarbonate;carbonodithioic acid, O-(1-methylpropyl) ester, sodium salt (1:1);Sodium Iso-butyl Xanthate; | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Structure: |