| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
120-55-8 |
| EC NO: |
204-407-6 |
| Molecular Formula: |
C18H18O5 |
| Molecular Weight: |
314.3325 |
| Specification: |
Assay 99.0% |
| InChI: |
InChI=1/C18H18O5/c1-13(22-17(19)15-9-5-3-6-10-15)21-14(2)23-18(20)16-11-7-4-8-12-16/h3-14H,1-2H3 |
| Packing: |
net 225kg iron drum |
Product description:
DIETHYLENE GLYCOL DIBENZOATE is a high solvating Dibenzoate plasticizer. Its main component is DIETHYLENE GLYCOL DIBENZOATE.As a replacement for phthalate plasticizers recommended by the European Chemical Agency(ECHA), it has been used for many years in a wide variety of applications, including adhesives, PS sealants, resilient flooring, PVC, artificial leather cloth, PVC coated cloth, etc. |
| Uses: |
Adhesives, PS sealants, resilient flooring, PVC, artificial leather cloth, PVC coated cloth, etc. |
| Synonyms: |
Diethylene glycol dibenzoate;oxydiethylene dibenzoate;2,2'-Oxydiethylene dibenzoate;Ethanol, 2,2'-oxybis-, dibenzoate;Polyol benzoate;oxydiethane-2,1-diyl dibenzoate;DEGDB; |
| Molecular Structure: |
 |