111Category: |
Others |
|
CAS NO: |
105-44-2 |
EC NO: |
203-298-2 |
Molecular Formula: |
C6H13NO |
Molecular Weight: |
115.1735 |
Specification: |
190kg |
InChI: |
InChI=1/C6H13NO/c1-5(2)4-6(3)7-8/h5,8H,4H2,1-3H3/b7-6+ |
Packing: |
drums |
Uses: |
It is used for oil-based paints, alkyd paints, epoxy ester paints, etc. to prevent surface crusts during use and storage, and is also the main raw material for the production of silicone crosslinkers |
Synonyms: |
2-Pentanone, 4-methyl-, oxime;2-Methyl-4-pentanone oxime;4-01-00-03307 (Beilstein Handbook Reference);4-Methyl-2-pentanone oxime;BRN 1741644;Methyl isobutyl ketoxime;Methyl isobutyl oxime;NSC 1070;USAF AM-4;4-Methylpentan-2-one oxime;N-hydroxy-4-methylpentan-2-imine;(2Z)-4-methylpentan-2-one oxime;(2E)-4-methylpentan-2-one oxime; |
Molecular Structure: |
 |