Details for Solvent Violet 59

Solvent Violet 59
111Category: |
Dyestuffs and Pigments |
|
CAS NO: |
6408-72-6 |
EC NO: |
229-066-0 |
Molecular Formula: |
C26H18N2O4 |
Molecular Weight: |
422.4321 |
Specification: |
|
InChI: |
InChI=1/C26H18N2O4/c27-21-19-20(24(30)18-14-8-7-13-17(18)23(19)29)22(28)26(32-16-11-5-2-6-12-16)25(21)31-15-9-3-1-4-10-15/h1-14H,27-28H2 |
Synonyms: |
C.I. 62025;C.I. Disperse Violet 31;C.I. Solvent Violet 59;Transparent Violet R;Disperse Violet 26;Violet HBL;1,4-diamino-2,3-diphenoxyanthracene-9,10-dione;Transparent Violet RL;Plast violet 4002;Solvent Violet 26;C.I.Disperse Violet 26; |
Molecular Structure: |
 |
if you are sourcing Solvent Violet 59 from China ,just feel free to inquire