Details for beta-Alanine ethyl ester hydrochloride

beta-Alanine ethyl ester hydrochloride
111Category: |
Organic chemicals and Derivatives/Others |
|
CAS NO: |
4244-84-2 |
EC NO: |
224-203-0 |
Molecular Formula: |
C5H12NO2 |
Molecular Weight: |
118.1537 |
Specification: |
|
InChI: |
InChI=1/C5H11NO2/c1-2-8-5(7)3-4-6/h2-4,6H2,1H3/p+1 |
Synonyms: |
beta-Alanine ethyl ester HCl;H-ß-Ala-OEt.HCl;3-aminopropionic acid ethyl ester hydrochloride;beta-alanine-oet hcl;¦Â-alanine ethyl ester hcl;¦Â-alanine ethyl ester hydrochloride;H-BETA-ALA-OET HCL;ethyl 3-aminopropanoate hydrochloride;ethyl beta-alaninate;ethyl beta-alaninate hydrochloride (1:1);3-ethoxy-3-oxopropan-1-aminium;¦Â-alanine ethyl ester HCL;H-¦Â-Ala-OEt¡¤HCl; |
Molecular Structure: |
 |
if you are sourcing beta-Alanine ethyl ester hydrochloride from China ,just feel free to inquire