Details for L-Valine
L-Valine
| 111Category: |
Food and Feed additives |
|
| CAS NO: |
72-18-4 |
| EC NO: |
200-773-6 |
| Molecular Formula: |
C5H11NO2 |
| Molecular Weight: |
117.1478 |
| Specification: |
USP/FCC |
| InChI: |
InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| Packing: |
25 KG DRUM |
| Uses: |
Nutritional supplement |
| Synonyms: |
L-2-Amino-3-methylbutyric acid;L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade;H-Val-OH;2-Amino-3-methylbutanoic acid;Lvaline;L-2-Aminoisovaleric acid;(S)-(+)-2-Amino-3-methylbutyric acid;;1-2-Amino-3-methylbutyric acid;Valine; |
| Molecular Structure: |
 |
if you are sourcing L-Valine from China ,just feel free to inquire
CN
China Suppliers > AWI > 
Search Product