Details for Methyl Amyl Ketone
![](/images/home/newal1.gif)
Methyl Amyl Ketone
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
110-43-0 |
EC NO: |
203-767-1 |
Molecular Formula: |
C7H14O |
Molecular Weight: |
114.1855 |
Specification: |
|
InChI: |
InChI=1/C7H14O/c1-3-4-5-6-7(2)8/h3-6H2,1-2H3 |
Synonyms: |
Methyl amyl ketone;n-Amyl methyl ketone;Methyl n-pentyl ketone;1-Methylhexanal;2-Heptanal;2-Heptanon;2-Ketoheptane;2-Oxoheptane;Amyl-methyl-cetone;amyl-methyl-cetone(french);heptan-2-one;MAK; |
Molecular Structure: |
![Methyl Amyl Ketone 110-43-0](https://images-a.chemnet.com/suppliers/chembase/364/3641.gif) |
if you are sourcing Methyl Amyl Ketone from Germany ,just feel free to inquire