Details for Methyl Isoamyl Ketone
Methyl Isoamyl Ketone
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
110-12-3 |
EC NO: |
203-737-8 |
Molecular Formula: |
C8H9BrO |
Molecular Weight: |
201.0605 |
Specification: |
|
InChI: |
InChI=1/C8H9BrO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-/m0/s1 |
Synonyms: |
Methyl isoamyl ketone;Isoamylmethylketone;Isopentyl methyl ketone~Methyl isoamyl ketone~MIAK;Isoamyl methyl ketone;5-methylhexan-2-one;(1R)-2-bromo-1-phenylethanol;MIAK; |
Molecular Structure: |
|
if you are sourcing Methyl Isoamyl Ketone from Germany ,just feel free to inquire