Details for Methyl Isobutyl Ketone
Methyl Isobutyl Ketone
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
108-10-1 |
EC NO: |
203-550-1 |
Molecular Formula: |
C6H12O |
Molecular Weight: |
100.1589 |
Specification: |
|
InChI: |
InChI=1/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3 |
Synonyms: |
Isobutyl methyl ketone;Isopropylacetone;Methyl isobutyl ketone;MIBK;Hexone;Methyl isobutyl keton;Methyl isobuty ketone;4-methylpentan-2-one; |
Molecular Structure: |
|
if you are sourcing Methyl Isobutyl Ketone from Germany ,just feel free to inquire