Details for Benzyl Butyrate

Benzyl Butyrate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
103-37-7 |
EC NO: |
203-105-1 |
Molecular Formula: |
C11H14O2 |
Molecular Weight: |
178.2277 |
Specification: |
|
InChI: |
InChI=1/C11H14O2/c1-2-6-11(12)13-9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3 |
Synonyms: |
Butanoic acid, phenylmethyl ester;4-06-00-02266 (Beilstein Handbook Reference);AI3-06120;BRN 2047625;Benzyl butanoate;Benzyl butyrate (natural);Benzyl n-butanoate;Benzyl n-butyrate;Benzylester kyseliny maselne;Benzylester kyseliny maselne [Czech];Butyric acid, benzyl ester;FEMA No. 2140;NSC 8073;Phenylmethyl butanoate;Phenylmethyl butyrate; |
Molecular Structure: |
 |
if you are sourcing Benzyl Butyrate from India ,just feel free to inquire