Details for Benzyl Propionate

Benzyl Propionate
111Category: |
Intermediates |
|
CAS NO: |
122-63-4 |
EC NO: |
204-559-3 |
Molecular Formula: |
C10H12O2 |
Molecular Weight: |
164.2011 |
Specification: |
|
InChI: |
InChI=1/C10H12O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
Product description:
Carbon monoxide, irritating and toxic fumes and gases, carbon dioxide.
|
Synonyms: |
Benzyl Propionate;propanoic acid, phenylmethyl ester;benzyl propanoate; |
Molecular Structure: |
 |
if you are sourcing Benzyl Propionate from India ,just feel free to inquire