Details for Indole-2-carboxylic acid
![](/images/home/newal1.gif)
Indole-2-carboxylic acid
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
1477-50-5 |
EC NO: |
216-030-4 |
Molecular Formula: |
C9H7NO2 |
Molecular Weight: |
161.15 |
Specification: |
|
InChI: |
InChI=1/C9H7NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,(H,11,12)/p-1 |
Synonyms: |
1H-Indole-2-carboxylic acid; Indole-2-carboxylic acid by poly ORGANIX or in R&D stage at Sanofi; 2-Indolecarboxylic acid;1H-indole-4-carboxylic acid;1H-indole-2-carboxylate;AKOS JY2082713;TIMTEC-BB SBB003953;2-Indole formic acid; |
Molecular Structure: |
![Indole-2-carboxylic acid 1477-50-5](https://images-a.chemnet.com/suppliers/chembase/177/1774.gif) |
if you are sourcing Indole-2-carboxylic acid from India ,just feel free to inquire