111Category: |
Intermediates/Pharmaceutical intermediates |
|
CAS NO: |
1719-76-2 |
EC NO: |
|
Molecular Formula: |
C4H10N2S |
Molecular Weight: |
118.2006 |
Specification: |
|
InChI: |
InChI=1/C4H10N2S/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7) |
Product description:
ELIMINATE all ignition sources. Do not touch damaged containers or spilled material unless wearing appropriate protective clothing. Stop leak if you can do it without risk. Absorb or cover with dry earth, sand or other non-combustible material and transfer to containers. DO NOT GET WATER INSIDE CONTAINERS.
|
Synonyms: |
Urea, 1-isopropyl-2-thio-;4-04-00-00525 (Beilstein Handbook Reference);BRN 1743052;Isopropyl thiourea;USAF D-6;1-propan-2-ylthiourea; |
Molecular Structure: |
![Isopropylthiourea 1719-76-2](https://images-a.chemnet.com/suppliers/chembase/cas3/cas1719-76-2.gif) |