Details for 4-Methoxy Phenyl Acetic Acid
4-Methoxy Phenyl Acetic Acid
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
104-01-8 |
EC NO: |
203-166-4 |
Molecular Formula: |
C8H8O3 |
Molecular Weight: |
152.1473 |
Specification: |
|
InChI: |
InChI=1/C8H8O3/c1-10-7-2-4-8(5-3-7)11-6-9/h2-6H,1H3 |
Synonyms: |
p-Methoxyphenylacetic acid;4-MethoxyPhenylAceticAcid;4-methoxy phenylacetic acid;Para methoxy phenyl acetic acid;4-methoxybenzyl formate;4-methoxyphenyl formate;4-MPAA; |
Molecular Structure: |
|
if you are sourcing 4-Methoxy Phenyl Acetic Acid from Israel ,just feel free to inquire