Details for Cyclohexane carboxylic acid chloride

Cyclohexane carboxylic acid chloride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
2719-27-9 |
| EC NO: |
220-322-7 |
| Molecular Formula: |
C7H11ClO |
| Molecular Weight: |
146.6146 |
| Specification: |
98% min |
| InChI: |
InChI=1/C7H11ClO/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| Packing: |
200 litres metallic drums with a polyethylene inner bag |
Product description:
CAS N.2719-27-9
Clear, colorless to straw liquid. |
| Synonyms: |
Cyclohexanecarbonyl chloride;Hexahydrobenzoyl chloride;Cyclohexyl Carboxylic Acid Chloride;7-Ethyl-3-(2-hydroxyethyl)indole;Cyclotexaformyl Chloride; |
| Molecular Structure: |
 |
if you are sourcing Cyclohexane carboxylic acid chloride from Italy ,just feel free to inquire