Details for Diethyl maleate
![](/images/home/newal1.gif)
Diethyl maleate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
141-05-9 |
EC NO: |
205-451-9 |
Molecular Formula: |
C8H12O4 |
Molecular Weight: |
172.1785 |
Specification: |
|
InChI: |
InChI=1/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5- |
Synonyms: |
Ethyl maleate;Maleic acid diethyl ester;cis-Propenoic acid diethyl ester;Diethyl malcate;diethyl but-2-enedioate;diethyl (2Z)-but-2-enedioate; |
Molecular Structure: |
![Diethyl maleate 141-05-9](https://images-a.chemnet.com/suppliers/chembase/115/1158.gif) |
if you are sourcing Diethyl maleate from Netherlands ,just feel free to inquire