Details for Dimethyl maleate
Dimethyl maleate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
624-48-6 |
EC NO: |
210-848-5 |
Molecular Formula: |
C6H8O4 |
Molecular Weight: |
144.1253 |
Specification: |
|
InChI: |
InChI=1/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
Synonyms: |
2-Butenedioic acid,dimethyl ester;Dimethylester kyseliny maleinove;Dimethyl cis-butenedioate:2-Butenedioic acid (Z)-, dimethyl ester;maleic acid dimethyl ester;dimethyl but-2-enedioate;dimethyl (2Z)-but-2-enedioate;DMM; |
Molecular Structure: |
|
if you are sourcing Dimethyl maleate from Netherlands ,just feel free to inquire