Details for 3-Aminocrotonic acid methyl ester

3-Aminocrotonic acid methyl ester
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
21731-17-9 |
| EC NO: |
244-549-6;238-056-5 |
| Molecular Formula: |
C5H9NO2 |
| Molecular Weight: |
115.1305 |
| Specification: |
|
| InChI: |
InChI=1/C5H9NO2/c1-4(6)3-5(7)8-2/h6H,3H2,1-2H3/b6-4+ |
| Synonyms: |
2-Butenoic acid, 3-amino-, methyl ester;methyl 3-amino-trans-but-2-enoate;3-Aminocrotonic acid methyl ester;Methyl-3-amino crotonate;methyl 3-aminobut-2-enoate;methyl (2E)-3-aminobut-2-enoate;methyl (2Z)-3-aminobut-2-enoate;methyl (3E)-3-iminobutanoate;Methyl β-aminobutenate;Methyl 3-aminocroton;Methyl-3-Aminocrotorate; |
| Molecular Structure: |
 |
if you are sourcing 3-Aminocrotonic acid methyl ester from Switzerland ,just feel free to inquire