Details for 4-Chloroacetoacetic acid ethyl ester
4-Chloroacetoacetic acid ethyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
638-07-3 |
EC NO: |
211-317-0 |
Molecular Formula: |
C9H13NO2 |
Molecular Weight: |
167.205 |
Specification: |
|
InChI: |
InChI=1/C9H13NO2/c1-2-7-3-4-8(10-5-7)9(12)6-11/h3-5,9,11-12H,2,6H2,1H3 |
Synonyms: |
Ethyl 4-chloro-3-oxobutanoate;ethyl 4-chloro acetoacetate;butanoic acid, 4-chloro-3-oxo-ethyl ester;ethyl 4-chloroacetoacetate;ethyl-gamma-chloroacetoacetate;4-chloro-3-oxo-butanoicaciethylester;4-chloro-acetoaceticaciethylester;ethyl-4-chloro aceto acetate;1-(5-ethyl-2-pyridyl)ethane-1,2-diol; |
Molecular Structure: |
|
if you are sourcing 4-Chloroacetoacetic acid ethyl ester from Switzerland ,just feel free to inquire