Details for DOA Plasticizer

DOA Plasticizer
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
103-23-1 |
EC NO: |
203-090-1 |
Molecular Formula: |
C22H42O4 |
Molecular Weight: |
370.5665 |
Specification: |
|
InChI: |
InChI=1/C22H42O4/c1-5-9-13-19(7-3)17-25-21(23)15-11-12-16-22(24)26-18-20(8-4)14-10-6-2/h19-20H,5-18H2,1-4H3/t19-,20+ |
Synonyms: |
bis(2-ethylhexyl) hexanedioate;dioctyl hexanedioate;Adipic acid bis(2-ethylhexyl) ester;Bis(2-ethylhexyl)hexanedioate;DOA Plasticizer;DOA |
Molecular Structure: |
 |
if you are sourcing DOA Plasticizer from United-States ,just feel free to inquire